About 1-tert-butyl-3-fluoro-4,5-dimethoxypyrazole
1-tert-butyl-3-fluoro-4,5-dimethoxypyrazole (PubChem CID 146377153) has the molecular formula C9H15FN2O2
and a molecular weight of 202.23 g/mol. Its IUPAC name is 1-tert-butyl-3-fluoro-4,5-dimethoxypyrazole.
Molecular Properties
| Compound Name | 1-tert-butyl-3-fluoro-4,5-dimethoxypyrazole |
| PubChem CID | 146377153 |
| Molecular Formula | C9H15FN2O2 |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-tert-butyl-3-fluoro-4,5-dimethoxypyrazole |
| SMILES | COc1c(F)nn(C(C)(C)C)c1OC |
| InChI | InChI=1S/C9H15FN2O2/c1-9(2,3)12-8(14-5)6(13-4)7(10)11-12/h1-5H3 |
| InChIKey | FKGKPGUAZDTFKC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-tert-butyl-3-fluoro-4,5-dimethoxypyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-fluoro-4,5-dimethoxypyrazole?
The IUPAC name of 1-tert-butyl-3-fluoro-4,5-dimethoxypyrazole (CID 146377153) is 1-tert-butyl-3-fluoro-4,5-dimethoxypyrazole.
What is the SMILES notation for 1-tert-butyl-3-fluoro-4,5-dimethoxypyrazole?
The canonical SMILES for 1-tert-butyl-3-fluoro-4,5-dimethoxypyrazole is COc1c(F)nn(C(C)(C)C)c1OC.
What is the InChIKey of 1-tert-butyl-3-fluoro-4,5-dimethoxypyrazole?
The InChIKey is FKGKPGUAZDTFKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15FN2O2/c1-9(2,3)12-8(14-5)6(13-4)7(10)11-12/h1-5H3.
What are the key properties of 1-tert-butyl-3-fluoro-4,5-dimethoxypyrazole?
1-tert-butyl-3-fluoro-4,5-dimethoxypyrazole has a molecular weight of 202.23 g/mol, XLogP of 1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-fluoro-4,5-dimethoxypyrazole is sourced from PubChem (CID 146377153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).