C13H20F2N2 — CID 146377311
4,5-difluoro-6-(3-methyloctan-3-yl)pyrimidine (PubChem CID 146377311) has the molecular formula C13H20F2N2 and a molecular weight of 242.31 g/mol. Its IUPAC name is 4,5-difluoro-6-(3-methyloctan-3-yl)pyrimidine.
| Compound Name | 4,5-difluoro-6-(3-methyloctan-3-yl)pyrimidine |
|---|---|
| PubChem CID | 146377311 |
| Molecular Formula | C13H20F2N2 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 4,5-difluoro-6-(3-methyloctan-3-yl)pyrimidine |
| SMILES | CCCCCC(C)(CC)c1ncnc(F)c1F |
| InChI | InChI=1S/C13H20F2N2/c1-4-6-7-8-13(3,5-2)11-10(14)12(15)17-9-16-11/h9H,4-8H2,1-3H3 |
| InChIKey | CCSSYLIRVJFDRT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|