C32H38FN5O3 — CID 146380126
1-[(3S)-4-[(7S)-2-[[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]-7-(3-hydroxynaphthalen-1-yl)-5,6,7,8-tetrahydroquinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 146380126) has the molecular formula C32H38FN5O3 and a molecular weight of 559.69 g/mol. Its IUPAC name is 1-[(3S)-4-[(7S)-2-[[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]-7-(3-hydroxynaphthalen-1-yl)-5,6,7,8-tetrahydroquinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S)-4-[(7S)-2-[[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]-7-(3-hydroxynaphthalen-1-yl)-5,6,7,8-tetrahydroquinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146380126 |
| Molecular Formula | C32H38FN5O3 |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | 1-[(3S)-4-[(7S)-2-[[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]-7-(3-hydroxynaphthalen-1-yl)-5,6,7,8-tetrahydroquinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nc(OC[C@@H]3C[C@@H](F)CN3C)nc3c2CC[C@H](c2cc(O)cc4ccccc24)C3)[C@@H](C)C1 |
| InChI | InChI=1S/C32H38FN5O3/c1-4-30(40)37-11-12-38(20(2)17-37)31-27-10-9-22(28-16-25(39)13-21-7-5-6-8-26(21)28)14-29(27)34-32(35-31)41-19-24-15-23(33)18-36(24)3/h4-8,13,16,20,22-24,39H,1,9-12,14-15,17-19H2,2-3H3/t20-,22-,23+,24-/m0/s1 |
| InChIKey | DUOUYBLCVWUUFI-XGAJZPNHSA-N |
| XLogP | 4.25 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|