C29H36F5N7O — CID 146380127
2-[4-[7-[3-amino-2-fluoro-5-methyl-6-(trifluoromethyl)phenyl]-2-[[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]-6-methyl-5,6,7,8-tetrahydroquinazolin-4-yl]piperazin-2-yl]acetonitrile (PubChem CID 146380127) has the molecular formula C29H36F5N7O and a molecular weight of 593.65 g/mol. Its IUPAC name is 2-[4-[7-[3-amino-2-fluoro-5-methyl-6-(trifluoromethyl)phenyl]-2-[[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]-6-methyl-5,6,7,8-tetrahydroquinazolin-4-yl]piperazin-2-yl]acetonitrile.
| Compound Name | 2-[4-[7-[3-amino-2-fluoro-5-methyl-6-(trifluoromethyl)phenyl]-2-[[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]-6-methyl-5,6,7,8-tetrahydroquinazolin-4-yl]piperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 146380127 |
| Molecular Formula | C29H36F5N7O |
| Molecular Weight | 593.65 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | 2-[4-[7-[3-amino-2-fluoro-5-methyl-6-(trifluoromethyl)phenyl]-2-[[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]-6-methyl-5,6,7,8-tetrahydroquinazolin-4-yl]piperazin-2-yl]acetonitrile |
| SMILES | Cc1cc(N)c(F)c(C2Cc3nc(OC[C@@H]4C[C@@H](F)CN4C)nc(N4CCNC(CC#N)C4)c3CC2C)c1C(F)(F)F |
| InChI | InChI=1S/C29H36F5N7O/c1-15-8-21-23(11-20(15)24-25(29(32,33)34)16(2)9-22(36)26(24)31)38-28(42-14-19-10-17(30)12-40(19)3)39-27(21)41-7-6-37-18(13-41)4-5-35/h9,15,17-20,37H,4,6-8,10-14,36H2,1-3H3/t15?,17-,18?,19+,20?/m1/s1 |
| InChIKey | IQXOBTQXSWVKRU-FPQDQXHWSA-N |
| XLogP | 4.16 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.65 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|