C20H17Cl2F3N2O2 — CID 146380615
benzyl 3-[[[1-(2,4-dichlorophenyl)-2,2,2-trifluoroethylidene]amino]methyl]azetidine-1-carboxylate (PubChem CID 146380615) has the molecular formula C20H17Cl2F3N2O2 and a molecular weight of 445.27 g/mol. Its IUPAC name is benzyl 3-[[[1-(2,4-dichlorophenyl)-2,2,2-trifluoroethylidene]amino]methyl]azetidine-1-carboxylate.
| Compound Name | benzyl 3-[[[1-(2,4-dichlorophenyl)-2,2,2-trifluoroethylidene]amino]methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 146380615 |
| Molecular Formula | C20H17Cl2F3N2O2 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | benzyl 3-[[[1-(2,4-dichlorophenyl)-2,2,2-trifluoroethylidene]amino]methyl]azetidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC(C/N=C(/c2ccc(Cl)cc2Cl)C(F)(F)F)C1 |
| InChI | InChI=1S/C20H17Cl2F3N2O2/c21-15-6-7-16(17(22)8-15)18(20(23,24)25)26-9-14-10-27(11-14)19(28)29-12-13-4-2-1-3-5-13/h1-8,14H,9-12H2/b26-18- |
| InChIKey | ZFUWUZJFPJYJFS-ITYLOYPMSA-N |
| XLogP | 5.61 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|