C14H17F3N2O2 — CID 146380644
4-[N-methyl-4-(trifluoromethyl)anilino]piperidine-1-carboxylic acid (PubChem CID 146380644) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is 4-[N-methyl-4-(trifluoromethyl)anilino]piperidine-1-carboxylic acid.
| Compound Name | 4-[N-methyl-4-(trifluoromethyl)anilino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 146380644 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 4-[N-methyl-4-(trifluoromethyl)anilino]piperidine-1-carboxylic acid |
| SMILES | CN(c1ccc(C(F)(F)F)cc1)C1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C14H17F3N2O2/c1-18(12-6-8-19(9-7-12)13(20)21)11-4-2-10(3-5-11)14(15,16)17/h2-5,12H,6-9H2,1H3,(H,20,21) |
| InChIKey | MCOBFLLYPCHVLK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |