C17H15F6N7O2 — CID 146381743
3-methoxy-1-(2,2,2-trifluoroethyl)-N-[6-[4-[(2R)-1,1,1-trifluoropropan-2-yl]-1,2,4-triazol-3-yl]-2-pyridinyl]pyrazole-4-carboxamide (PubChem CID 146381743) has the molecular formula C17H15F6N7O2 and a molecular weight of 463.34 g/mol. Its IUPAC name is 3-methoxy-1-(2,2,2-trifluoroethyl)-N-[6-[4-[(2R)-1,1,1-trifluoropropan-2-yl]-1,2,4-triazol-3-yl]-2-pyridinyl]pyrazole-4-carboxamide.
| Compound Name | 3-methoxy-1-(2,2,2-trifluoroethyl)-N-[6-[4-[(2R)-1,1,1-trifluoropropan-2-yl]-1,2,4-triazol-3-yl]-2-pyridinyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 146381743 |
| Molecular Formula | C17H15F6N7O2 |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 3-methoxy-1-(2,2,2-trifluoroethyl)-N-[6-[4-[(2R)-1,1,1-trifluoropropan-2-yl]-1,2,4-triazol-3-yl]-2-pyridinyl]pyrazole-4-carboxamide |
| SMILES | COc1nn(CC(F)(F)F)cc1C(=O)Nc1cccc(-c2nncn2[C@H](C)C(F)(F)F)n1 |
| InChI | InChI=1S/C17H15F6N7O2/c1-9(17(21,22)23)30-8-24-27-13(30)11-4-3-5-12(25-11)26-14(31)10-6-29(7-16(18,19)20)28-15(10)32-2/h3-6,8-9H,7H2,1-2H3,(H,25,26,31)/t9-/m1/s1 |
| InChIKey | DXWUXPKKSJLAJZ-SECBINFHSA-N |
| XLogP | 3.48 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |