C28H23F3N6O4 — CID 146382291
3-[11-(6,6-difluoro-1,4-oxazepane-4-carbonyl)-2-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-5-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione (PubChem CID 146382291) has the molecular formula C28H23F3N6O4 and a molecular weight of 564.52 g/mol. Its IUPAC name is 3-[11-(6,6-difluoro-1,4-oxazepane-4-carbonyl)-2-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-5-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione.
| Compound Name | 3-[11-(6,6-difluoro-1,4-oxazepane-4-carbonyl)-2-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-5-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 146382291 |
| Molecular Formula | C28H23F3N6O4 |
| Molecular Weight | 564.52 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 3-[11-(6,6-difluoro-1,4-oxazepane-4-carbonyl)-2-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-5-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cnc3ccccn23)=C1c1ccc2c3c1cc(F)n3CC(C(=O)N1CCOCC(F)(F)C1)NC2 |
| InChI | InChI=1S/C28H23F3N6O4/c29-20-9-17-16(22-23(26(39)34-25(22)38)19-11-33-21-3-1-2-6-36(19)21)5-4-15-10-32-18(12-37(20)24(15)17)27(40)35-7-8-41-14-28(30,31)13-35/h1-6,9,11,18,32H,7-8,10,12-14H2,(H,34,38,39) |
| InChIKey | FULHJXTYOYKOHF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.52 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|