C10H19O4PS — CID 146382535
[(1R,3S,5R)-3-methanethioyl-5-propan-2-ylcyclohexyl] dihydrogen phosphate (PubChem CID 146382535) has the molecular formula C10H19O4PS and a molecular weight of 266.30 g/mol. Its IUPAC name is [(1R,3S,5R)-3-methanethioyl-5-propan-2-ylcyclohexyl] dihydrogen phosphate.
| Compound Name | [(1R,3S,5R)-3-methanethioyl-5-propan-2-ylcyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 146382535 |
| Molecular Formula | C10H19O4PS |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | [(1R,3S,5R)-3-methanethioyl-5-propan-2-ylcyclohexyl] dihydrogen phosphate |
| SMILES | CC(C)[C@@H]1C[C@H](C=S)C[C@H](OP(=O)(O)O)C1 |
| InChI | InChI=1S/C10H19O4PS/c1-7(2)9-3-8(6-16)4-10(5-9)14-15(11,12)13/h6-10H,3-5H2,1-2H3,(H2,11,12,13)/t8-,9+,10-/m0/s1 |
| InChIKey | OHLVNADFWUKVJQ-AEJSXWLSSA-N |
| XLogP | 2.54 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|