About (4R)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidin-5-one
(4R)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidin-5-one (PubChem CID 146383170) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is (4R)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidin-5-one.
Molecular Properties
| Compound Name | (4R)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidin-5-one |
| PubChem CID | 146383170 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (4R)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidin-5-one |
| SMILES | CC1(C)N[C@H](CO)C(=O)O1 |
| InChI | InChI=1S/C6H11NO3/c1-6(2)7-4(3-8)5(9)10-6/h4,7-8H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | GFBZJKYHKHGHMI-SCSAIBSYSA-N |
| XLogP | -0.77 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidin-5-one?
The IUPAC name of (4R)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidin-5-one (CID 146383170) is (4R)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidin-5-one.
What is the SMILES notation for (4R)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidin-5-one?
The canonical SMILES for (4R)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidin-5-one is CC1(C)N[C@H](CO)C(=O)O1.
What is the InChIKey of (4R)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidin-5-one?
The InChIKey is GFBZJKYHKHGHMI-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H11NO3/c1-6(2)7-4(3-8)5(9)10-6/h4,7-8H,3H2,1-2H3/t4-/m1/s1.
What are the key properties of (4R)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidin-5-one?
(4R)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidin-5-one has a molecular weight of 145.16 g/mol, XLogP of -0.77, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidin-5-one is sourced from PubChem (CID 146383170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).