C20H23F3N6O2 — CID 146383622
N-[(5S)-3-(3-methyl-1,2-oxazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-[(2R)-1,1,1-trifluoropropan-2-yl]oxy-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 146383622) has the molecular formula C20H23F3N6O2 and a molecular weight of 436.44 g/mol. Its IUPAC name is N-[(5S)-3-(3-methyl-1,2-oxazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-[(2R)-1,1,1-trifluoropropan-2-yl]oxy-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(5S)-3-(3-methyl-1,2-oxazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-[(2R)-1,1,1-trifluoropropan-2-yl]oxy-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 146383622 |
| Molecular Formula | C20H23F3N6O2 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-[(5S)-3-(3-methyl-1,2-oxazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-[(2R)-1,1,1-trifluoropropan-2-yl]oxy-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(N2CC3CC[C@@H](C2)C3Nc2nc3c(O[C@H](C)C(F)(F)F)cccn3n2)on1 |
| InChI | InChI=1S/C20H23F3N6O2/c1-11-8-16(31-27-11)28-9-13-5-6-14(10-28)17(13)24-19-25-18-15(4-3-7-29(18)26-19)30-12(2)20(21,22)23/h3-4,7-8,12-14,17H,5-6,9-10H2,1-2H3,(H,24,26)/t12-,13+,14?,17?/m1/s1 |
| InChIKey | HYVGBFWQJGYZGB-YFTKNLTDSA-N |
| XLogP | 3.68 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |