About 6-(2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one
6-(2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 14638421) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is 6-(2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one.
Molecular Properties
| Compound Name | 6-(2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one |
| PubChem CID | 14638421 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 6-(2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC(O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C9H14O4/c1-6(10)4-7-5-8(11)13-9(2,3)12-7/h5-6,10H,4H2,1-3H3 |
| InChIKey | QFQPMOQBTIOSKZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one?
The IUPAC name of 6-(2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one (CID 14638421) is 6-(2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one.
What is the SMILES notation for 6-(2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one?
The canonical SMILES for 6-(2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one is CC(O)CC1=CC(=O)OC(C)(C)O1.
What is the InChIKey of 6-(2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one?
The InChIKey is QFQPMOQBTIOSKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-6(10)4-7-5-8(11)13-9(2,3)12-7/h5-6,10H,4H2,1-3H3.
What are the key properties of 6-(2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one?
6-(2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one has a molecular weight of 186.21 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one is sourced from PubChem (CID 14638421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).