About 2,2-dimethyl-6-(3-oxobutyl)-1,3-dioxin-4-one
2,2-dimethyl-6-(3-oxobutyl)-1,3-dioxin-4-one (PubChem CID 14638423) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 2,2-dimethyl-6-(3-oxobutyl)-1,3-dioxin-4-one.
Molecular Properties
| Compound Name | 2,2-dimethyl-6-(3-oxobutyl)-1,3-dioxin-4-one |
| PubChem CID | 14638423 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2,2-dimethyl-6-(3-oxobutyl)-1,3-dioxin-4-one |
| SMILES | CC(=O)CCC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C10H14O4/c1-7(11)4-5-8-6-9(12)14-10(2,3)13-8/h6H,4-5H2,1-3H3 |
| InChIKey | QQTCOYVGHQUSDZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-dimethyl-6-(3-oxobutyl)-1,3-dioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-6-(3-oxobutyl)-1,3-dioxin-4-one?
The IUPAC name of 2,2-dimethyl-6-(3-oxobutyl)-1,3-dioxin-4-one (CID 14638423) is 2,2-dimethyl-6-(3-oxobutyl)-1,3-dioxin-4-one.
What is the SMILES notation for 2,2-dimethyl-6-(3-oxobutyl)-1,3-dioxin-4-one?
The canonical SMILES for 2,2-dimethyl-6-(3-oxobutyl)-1,3-dioxin-4-one is CC(=O)CCC1=CC(=O)OC(C)(C)O1.
What is the InChIKey of 2,2-dimethyl-6-(3-oxobutyl)-1,3-dioxin-4-one?
The InChIKey is QQTCOYVGHQUSDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-7(11)4-5-8-6-9(12)14-10(2,3)13-8/h6H,4-5H2,1-3H3.
What are the key properties of 2,2-dimethyl-6-(3-oxobutyl)-1,3-dioxin-4-one?
2,2-dimethyl-6-(3-oxobutyl)-1,3-dioxin-4-one has a molecular weight of 198.22 g/mol, XLogP of 1.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-6-(3-oxobutyl)-1,3-dioxin-4-one is sourced from PubChem (CID 14638423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).