C17H16ClF4N3O2S — CID 146384263
N-(5-chloro-3,4-difluoro-2-methylphenyl)-4-(3,3-difluorocyclobutyl)sulfinamoyl-1-methylpyrrole-2-carboxamide (PubChem CID 146384263) has the molecular formula C17H16ClF4N3O2S and a molecular weight of 437.85 g/mol. Its IUPAC name is N-(5-chloro-3,4-difluoro-2-methylphenyl)-4-(3,3-difluorocyclobutyl)sulfinamoyl-1-methylpyrrole-2-carboxamide.
| Compound Name | N-(5-chloro-3,4-difluoro-2-methylphenyl)-4-(3,3-difluorocyclobutyl)sulfinamoyl-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 146384263 |
| Molecular Formula | C17H16ClF4N3O2S |
| Molecular Weight | 437.85 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | N-(5-chloro-3,4-difluoro-2-methylphenyl)-4-(3,3-difluorocyclobutyl)sulfinamoyl-1-methylpyrrole-2-carboxamide |
| SMILES | Cc1c(NC(=O)c2cc(S(=O)NC3CC(F)(F)C3)cn2C)cc(Cl)c(F)c1F |
| InChI | InChI=1S/C17H16ClF4N3O2S/c1-8-12(4-11(18)15(20)14(8)19)23-16(26)13-3-10(7-25(13)2)28(27)24-9-5-17(21,22)6-9/h3-4,7,9,24H,5-6H2,1-2H3,(H,23,26) |
| InChIKey | BHJPOXDXOIUOBA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.85 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|