C12H22F3NO2S — CID 146384511
1,1,1-trifluoro-N-[(E)-3,7,7-trimethyloct-2-enyl]methanesulfonamide (PubChem CID 146384511) has the molecular formula C12H22F3NO2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[(E)-3,7,7-trimethyloct-2-enyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[(E)-3,7,7-trimethyloct-2-enyl]methanesulfonamide |
|---|---|
| PubChem CID | 146384511 |
| Molecular Formula | C12H22F3NO2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 1,1,1-trifluoro-N-[(E)-3,7,7-trimethyloct-2-enyl]methanesulfonamide |
| SMILES | C/C(=C\CNS(=O)(=O)C(F)(F)F)CCCC(C)(C)C |
| InChI | InChI=1S/C12H22F3NO2S/c1-10(6-5-8-11(2,3)4)7-9-16-19(17,18)12(13,14)15/h7,16H,5-6,8-9H2,1-4H3/b10-7+ |
| InChIKey | PUNNSHZLGJWHIC-JXMROGBWSA-N |
| XLogP | 3.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|