C7H10FN — CID 146384609
6-fluoro-1,4-dimethyl-2H-pyridine (PubChem CID 146384609) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is 6-fluoro-1,4-dimethyl-2H-pyridine.
| Compound Name | 6-fluoro-1,4-dimethyl-2H-pyridine |
|---|---|
| PubChem CID | 146384609 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | 6-fluoro-1,4-dimethyl-2H-pyridine |
| SMILES | CC1=CCN(C)C(F)=C1 |
| InChI | InChI=1S/C7H10FN/c1-6-3-4-9(2)7(8)5-6/h3,5H,4H2,1-2H3 |
| InChIKey | UHDPHUAOLMIWIZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|