C28H42N2O3S2 — CID 146385137
N-[2-acetyl-5-[2-methylpropyl-(3,4,4,7,7-pentamethyl-5,6-dihydro-1-benzothiophen-2-yl)amino]phenyl]propane-1-sulfonamide (PubChem CID 146385137) has the molecular formula C28H42N2O3S2 and a molecular weight of 518.79 g/mol. Its IUPAC name is N-[2-acetyl-5-[2-methylpropyl-(3,4,4,7,7-pentamethyl-5,6-dihydro-1-benzothiophen-2-yl)amino]phenyl]propane-1-sulfonamide.
| Compound Name | N-[2-acetyl-5-[2-methylpropyl-(3,4,4,7,7-pentamethyl-5,6-dihydro-1-benzothiophen-2-yl)amino]phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 146385137 |
| Molecular Formula | C28H42N2O3S2 |
| Molecular Weight | 518.79 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | N-[2-acetyl-5-[2-methylpropyl-(3,4,4,7,7-pentamethyl-5,6-dihydro-1-benzothiophen-2-yl)amino]phenyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1cc(N(CC(C)C)c2sc3c(c2C)C(C)(C)CCC3(C)C)ccc1C(C)=O |
| InChI | InChI=1S/C28H42N2O3S2/c1-10-15-35(32,33)29-23-16-21(11-12-22(23)20(5)31)30(17-18(2)3)26-19(4)24-25(34-26)28(8,9)14-13-27(24,6)7/h11-12,16,18,29H,10,13-15,17H2,1-9H3 |
| InChIKey | QYWQNZIEBBSAGJ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.79 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |