C10H17NO3 — CID 14638531
8-hydroxy-5-propyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 14638531) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 8-hydroxy-5-propyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | 8-hydroxy-5-propyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 14638531 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 8-hydroxy-5-propyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | CCCC1CCC(O)C2COC(=O)N12 |
| InChI | InChI=1S/C10H17NO3/c1-2-3-7-4-5-9(12)8-6-14-10(13)11(7)8/h7-9,12H,2-6H2,1H3 |
| InChIKey | VGEHEUNMMALEQA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |