C18H23NO8 — CID 146385336
[4-hydroxy-5-methoxy-6,6-dimethyl-2-[(2-oxo-3,4-dihydrochromen-8-yl)oxy]oxan-3-yl] carbamate (PubChem CID 146385336) has the molecular formula C18H23NO8 and a molecular weight of 381.38 g/mol. Its IUPAC name is [4-hydroxy-5-methoxy-6,6-dimethyl-2-[(2-oxo-3,4-dihydrochromen-8-yl)oxy]oxan-3-yl] carbamate.
| Compound Name | [4-hydroxy-5-methoxy-6,6-dimethyl-2-[(2-oxo-3,4-dihydrochromen-8-yl)oxy]oxan-3-yl] carbamate |
|---|---|
| PubChem CID | 146385336 |
| Molecular Formula | C18H23NO8 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | [4-hydroxy-5-methoxy-6,6-dimethyl-2-[(2-oxo-3,4-dihydrochromen-8-yl)oxy]oxan-3-yl] carbamate |
| SMILES | COC1C(O)C(OC(N)=O)C(Oc2cccc3c2OC(=O)CC3)OC1(C)C |
| InChI | InChI=1S/C18H23NO8/c1-18(2)15(23-3)12(21)14(26-17(19)22)16(27-18)24-10-6-4-5-9-7-8-11(20)25-13(9)10/h4-6,12,14-16,21H,7-8H2,1-3H3,(H2,19,22) |
| InChIKey | POBORCHQHPVEJG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|