C48H88N2 — CID 146385702
N'-[(9Z,12Z)-heptadeca-9,12-dienyl]-N,N-dimethyl-3-methylidene-5-[(12Z,15Z)-3-methylideneicosa-12,15-dienyl]heptane-1,7-diamine (PubChem CID 146385702) has the molecular formula C48H88N2 and a molecular weight of 693.25 g/mol. Its IUPAC name is N'-[(9Z,12Z)-heptadeca-9,12-dienyl]-N,N-dimethyl-3-methylidene-5-[(12Z,15Z)-3-methylideneicosa-12,15-dienyl]heptane-1,7-diamine.
| Compound Name | N'-[(9Z,12Z)-heptadeca-9,12-dienyl]-N,N-dimethyl-3-methylidene-5-[(12Z,15Z)-3-methylideneicosa-12,15-dienyl]heptane-1,7-diamine |
|---|---|
| PubChem CID | 146385702 |
| Molecular Formula | C48H88N2 |
| Molecular Weight | 693.25 g/mol |
| Exact Mass | 692.69 |
| IUPAC Name | N'-[(9Z,12Z)-heptadeca-9,12-dienyl]-N,N-dimethyl-3-methylidene-5-[(12Z,15Z)-3-methylideneicosa-12,15-dienyl]heptane-1,7-diamine |
| SMILES | C=C(CCCCCCCC/C=C\C/C=C\CCCC)CCC(CCNCCCCCCCC/C=C\C/C=C\CCCC)CC(=C)CCN(C)C |
| InChI | InChI=1S/C48H88N2/c1-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-46(3)38-39-48(45-47(4)41-44-50(5)6)40-43-49-42-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-2/h13-16,19-22,48-49H,3-4,7-12,17-18,23-45H2,1-2,5-6H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | KHFVKJWWGXFPPB-KWXKLSQISA-N |
| XLogP | 15.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.25 |
| LogP ≤ 5 | 15.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|