C28H32N4O2S — CID 146385834
1-[6-methyl-5-[2-(1-methylpiperidin-4-yl)oxy-4-pyridinyl]-2,3-dihydro-1H-inden-4-yl]-3-phenylsulfanylurea (PubChem CID 146385834) has the molecular formula C28H32N4O2S and a molecular weight of 488.66 g/mol. Its IUPAC name is 1-[6-methyl-5-[2-(1-methylpiperidin-4-yl)oxy-4-pyridinyl]-2,3-dihydro-1H-inden-4-yl]-3-phenylsulfanylurea.
| Compound Name | 1-[6-methyl-5-[2-(1-methylpiperidin-4-yl)oxy-4-pyridinyl]-2,3-dihydro-1H-inden-4-yl]-3-phenylsulfanylurea |
|---|---|
| PubChem CID | 146385834 |
| Molecular Formula | C28H32N4O2S |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 1-[6-methyl-5-[2-(1-methylpiperidin-4-yl)oxy-4-pyridinyl]-2,3-dihydro-1H-inden-4-yl]-3-phenylsulfanylurea |
| SMILES | Cc1cc2c(c(NC(=O)NSc3ccccc3)c1-c1ccnc(OC3CCN(C)CC3)c1)CCC2 |
| InChI | InChI=1S/C28H32N4O2S/c1-19-17-20-7-6-10-24(20)27(30-28(33)31-35-23-8-4-3-5-9-23)26(19)21-11-14-29-25(18-21)34-22-12-15-32(2)16-13-22/h3-5,8-9,11,14,17-18,22H,6-7,10,12-13,15-16H2,1-2H3,(H2,30,31,33) |
| InChIKey | GRXVQFQMLUWUJY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|