About [2-methyl-1-[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]propan-2-yl] imidazole-1-carboxylate
[2-methyl-1-[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]propan-2-yl] imidazole-1-carboxylate (PubChem CID 146386164) has the molecular formula C14H18F3N3O4
and a molecular weight of 349.31 g/mol. Its IUPAC name is [2-methyl-1-[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]propan-2-yl] imidazole-1-carboxylate.
Molecular Properties
| Compound Name | [2-methyl-1-[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]propan-2-yl] imidazole-1-carboxylate |
| PubChem CID | 146386164 |
| Molecular Formula | C14H18F3N3O4 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [2-methyl-1-[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]propan-2-yl] imidazole-1-carboxylate |
| SMILES | CC(C)(CC1CN(C(=O)C(F)(F)F)CCO1)OC(=O)n1ccnc1 |
| InChI | InChI=1S/C14H18F3N3O4/c1-13(2,24-12(22)20-4-3-18-9-20)7-10-8-19(5-6-23-10)11(21)14(15,16)17/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | ASTGJOQJALKHCP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-methyl-1-[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]propan-2-yl] imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-1-[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]propan-2-yl] imidazole-1-carboxylate?
The IUPAC name of [2-methyl-1-[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]propan-2-yl] imidazole-1-carboxylate (CID 146386164) is [2-methyl-1-[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]propan-2-yl] imidazole-1-carboxylate.
What is the SMILES notation for [2-methyl-1-[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]propan-2-yl] imidazole-1-carboxylate?
The canonical SMILES for [2-methyl-1-[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]propan-2-yl] imidazole-1-carboxylate is CC(C)(CC1CN(C(=O)C(F)(F)F)CCO1)OC(=O)n1ccnc1.
What is the InChIKey of [2-methyl-1-[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]propan-2-yl] imidazole-1-carboxylate?
The InChIKey is ASTGJOQJALKHCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F3N3O4/c1-13(2,24-12(22)20-4-3-18-9-20)7-10-8-19(5-6-23-10)11(21)14(15,16)17/h3-4,9-10H,5-8H2,1-2H3.
What are the key properties of [2-methyl-1-[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]propan-2-yl] imidazole-1-carboxylate?
[2-methyl-1-[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]propan-2-yl] imidazole-1-carboxylate has a molecular weight of 349.31 g/mol, XLogP of 1.83, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-1-[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]propan-2-yl] imidazole-1-carboxylate is sourced from PubChem (CID 146386164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).