About 2-(aminomethyl)-N,N-dimethyl-1,2-dihydropyrimidin-6-amine
2-(aminomethyl)-N,N-dimethyl-1,2-dihydropyrimidin-6-amine (PubChem CID 146386443) has the molecular formula C7H14N4
and a molecular weight of 154.22 g/mol. Its IUPAC name is 2-(aminomethyl)-N,N-dimethyl-1,2-dihydropyrimidin-6-amine.
Molecular Properties
| Compound Name | 2-(aminomethyl)-N,N-dimethyl-1,2-dihydropyrimidin-6-amine |
| PubChem CID | 146386443 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 2-(aminomethyl)-N,N-dimethyl-1,2-dihydropyrimidin-6-amine |
| SMILES | CN(C)C1=CC=NC(CN)N1 |
| InChI | InChI=1S/C7H14N4/c1-11(2)7-3-4-9-6(5-8)10-7/h3-4,6,10H,5,8H2,1-2H3 |
| InChIKey | WRPROKAUCQXPKW-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(aminomethyl)-N,N-dimethyl-1,2-dihydropyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-N,N-dimethyl-1,2-dihydropyrimidin-6-amine?
The IUPAC name of 2-(aminomethyl)-N,N-dimethyl-1,2-dihydropyrimidin-6-amine (CID 146386443) is 2-(aminomethyl)-N,N-dimethyl-1,2-dihydropyrimidin-6-amine.
What is the SMILES notation for 2-(aminomethyl)-N,N-dimethyl-1,2-dihydropyrimidin-6-amine?
The canonical SMILES for 2-(aminomethyl)-N,N-dimethyl-1,2-dihydropyrimidin-6-amine is CN(C)C1=CC=NC(CN)N1.
What is the InChIKey of 2-(aminomethyl)-N,N-dimethyl-1,2-dihydropyrimidin-6-amine?
The InChIKey is WRPROKAUCQXPKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4/c1-11(2)7-3-4-9-6(5-8)10-7/h3-4,6,10H,5,8H2,1-2H3.
What are the key properties of 2-(aminomethyl)-N,N-dimethyl-1,2-dihydropyrimidin-6-amine?
2-(aminomethyl)-N,N-dimethyl-1,2-dihydropyrimidin-6-amine has a molecular weight of 154.22 g/mol, XLogP of -0.65, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-N,N-dimethyl-1,2-dihydropyrimidin-6-amine is sourced from PubChem (CID 146386443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).