About 1-[(2Z)-2-ethylpenta-2,4-dienyl]-1-(2-methylpropyl)hydrazine
1-[(2Z)-2-ethylpenta-2,4-dienyl]-1-(2-methylpropyl)hydrazine (PubChem CID 146386489) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 1-[(2Z)-2-ethylpenta-2,4-dienyl]-1-(2-methylpropyl)hydrazine.
Molecular Properties
| Compound Name | 1-[(2Z)-2-ethylpenta-2,4-dienyl]-1-(2-methylpropyl)hydrazine |
| PubChem CID | 146386489 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1-[(2Z)-2-ethylpenta-2,4-dienyl]-1-(2-methylpropyl)hydrazine |
| SMILES | C=C/C=C(/CC)CN(N)CC(C)C |
| InChI | InChI=1S/C11H22N2/c1-5-7-11(6-2)9-13(12)8-10(3)4/h5,7,10H,1,6,8-9,12H2,2-4H3/b11-7- |
| InChIKey | UQEVIIPKAYAXFO-XFFZJAGNSA-N |
| XLogP | 2.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2Z)-2-ethylpenta-2,4-dienyl]-1-(2-methylpropyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2Z)-2-ethylpenta-2,4-dienyl]-1-(2-methylpropyl)hydrazine?
The IUPAC name of 1-[(2Z)-2-ethylpenta-2,4-dienyl]-1-(2-methylpropyl)hydrazine (CID 146386489) is 1-[(2Z)-2-ethylpenta-2,4-dienyl]-1-(2-methylpropyl)hydrazine.
What is the SMILES notation for 1-[(2Z)-2-ethylpenta-2,4-dienyl]-1-(2-methylpropyl)hydrazine?
The canonical SMILES for 1-[(2Z)-2-ethylpenta-2,4-dienyl]-1-(2-methylpropyl)hydrazine is C=C/C=C(/CC)CN(N)CC(C)C.
What is the InChIKey of 1-[(2Z)-2-ethylpenta-2,4-dienyl]-1-(2-methylpropyl)hydrazine?
The InChIKey is UQEVIIPKAYAXFO-XFFZJAGNSA-N. The full InChI is InChI=1S/C11H22N2/c1-5-7-11(6-2)9-13(12)8-10(3)4/h5,7,10H,1,6,8-9,12H2,2-4H3/b11-7-.
What are the key properties of 1-[(2Z)-2-ethylpenta-2,4-dienyl]-1-(2-methylpropyl)hydrazine?
1-[(2Z)-2-ethylpenta-2,4-dienyl]-1-(2-methylpropyl)hydrazine has a molecular weight of 182.31 g/mol, XLogP of 2.34, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2Z)-2-ethylpenta-2,4-dienyl]-1-(2-methylpropyl)hydrazine is sourced from PubChem (CID 146386489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).