C36H28ClN11O — CID 146387214
2-[3-[5-amino-8-(3-chloro-4-methoxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]phenyl]-8-(2,6-dimethyl-4-pyridinyl)-7-phenyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine (PubChem CID 146387214) has the molecular formula C36H28ClN11O and a molecular weight of 666.15 g/mol. Its IUPAC name is 2-[3-[5-amino-8-(3-chloro-4-methoxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]phenyl]-8-(2,6-dimethyl-4-pyridinyl)-7-phenyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | 2-[3-[5-amino-8-(3-chloro-4-methoxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]phenyl]-8-(2,6-dimethyl-4-pyridinyl)-7-phenyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 146387214 |
| Molecular Formula | C36H28ClN11O |
| Molecular Weight | 666.15 g/mol |
| Exact Mass | 665.22 |
| IUPAC Name | 2-[3-[5-amino-8-(3-chloro-4-methoxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]phenyl]-8-(2,6-dimethyl-4-pyridinyl)-7-phenyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
| SMILES | COc1ccc(-c2c(-c3cccc(-c4nc5c(-c6cc(C)nc(C)c6)c(-c6ccccc6)nc(N)n5n4)c3)nc(N)n3ncnc23)cc1Cl |
| InChI | InChI=1S/C36H28ClN11O/c1-19-14-25(15-20(2)42-19)29-30(21-8-5-4-6-9-21)43-36(39)48-34(29)45-32(46-48)24-11-7-10-23(16-24)31-28(22-12-13-27(49-3)26(37)17-22)33-40-18-41-47(33)35(38)44-31/h4-18H,1-3H3,(H2,38,44)(H2,39,43) |
| InChIKey | HURXYHGEYIUKTL-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.15 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |