C20H20N8O — CID 146387238
8-(3-amino-4-diazenylphenyl)-2-ethyl-7-(2-methoxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine (PubChem CID 146387238) has the molecular formula C20H20N8O and a molecular weight of 388.44 g/mol. Its IUPAC name is 8-(3-amino-4-diazenylphenyl)-2-ethyl-7-(2-methoxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | 8-(3-amino-4-diazenylphenyl)-2-ethyl-7-(2-methoxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 146387238 |
| Molecular Formula | C20H20N8O |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 8-(3-amino-4-diazenylphenyl)-2-ethyl-7-(2-methoxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
| SMILES | [H]/N=N/c1ccc(-c2c(-c3ccccc3OC)nc(N)n3nc(CC)nc23)cc1N |
| InChI | InChI=1S/C20H20N8O/c1-3-16-24-19-17(11-8-9-14(26-23)13(21)10-11)18(25-20(22)28(19)27-16)12-6-4-5-7-15(12)29-2/h4-10,23H,3,21H2,1-2H3,(H2,22,25)/b26-23+ |
| InChIKey | URUNESHIWYUHLO-WNAAXNPUSA-N |
| XLogP | 3.86 |
| TPSA | 140.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|