C21H19ClF3N3O — CID 146387772
2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 146387772) has the molecular formula C21H19ClF3N3O and a molecular weight of 421.85 g/mol. Its IUPAC name is 2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 146387772 |
| Molecular Formula | C21H19ClF3N3O |
| Molecular Weight | 421.85 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | O=C(CN1CCc2c([nH]c3ccc(Cl)cc23)C1)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19ClF3N3O/c22-15-5-6-18-17(9-15)16-7-8-28(11-19(16)27-18)12-20(29)26-10-13-1-3-14(4-2-13)21(23,24)25/h1-6,9,27H,7-8,10-12H2,(H,26,29) |
| InChIKey | ALXCYTGBQITIFV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.85 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|