C21H24Cl2N4O2 — CID 146387857
[6-chloro-2-[2-[(5-chloro-6-ethoxy-2-pyridinyl)amino]ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]methanol (PubChem CID 146387857) has the molecular formula C21H24Cl2N4O2 and a molecular weight of 435.36 g/mol. Its IUPAC name is [6-chloro-2-[2-[(5-chloro-6-ethoxy-2-pyridinyl)amino]ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]methanol.
| Compound Name | [6-chloro-2-[2-[(5-chloro-6-ethoxy-2-pyridinyl)amino]ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]methanol |
|---|---|
| PubChem CID | 146387857 |
| Molecular Formula | C21H24Cl2N4O2 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | [6-chloro-2-[2-[(5-chloro-6-ethoxy-2-pyridinyl)amino]ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]methanol |
| SMILES | CCOc1nc(NCCN2CCc3c([nH]c4ccc(Cl)cc34)C2CO)ccc1Cl |
| InChI | InChI=1S/C21H24Cl2N4O2/c1-2-29-21-16(23)4-6-19(26-21)24-8-10-27-9-7-14-15-11-13(22)3-5-17(15)25-20(14)18(27)12-28/h3-6,11,18,25,28H,2,7-10,12H2,1H3,(H,24,26) |
| InChIKey | GUQGAZLISKFDIM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 73.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|