C15H16FN3 — CID 146388088
6-[2-(3-fluorophenyl)pyrrolidin-1-yl]pyridin-3-amine (PubChem CID 146388088) has the molecular formula C15H16FN3 and a molecular weight of 257.31 g/mol. Its IUPAC name is 6-[2-(3-fluorophenyl)pyrrolidin-1-yl]pyridin-3-amine.
| Compound Name | 6-[2-(3-fluorophenyl)pyrrolidin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 146388088 |
| Molecular Formula | C15H16FN3 |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 6-[2-(3-fluorophenyl)pyrrolidin-1-yl]pyridin-3-amine |
| SMILES | Nc1ccc(N2CCCC2c2cccc(F)c2)nc1 |
| InChI | InChI=1S/C15H16FN3/c16-12-4-1-3-11(9-12)14-5-2-8-19(14)15-7-6-13(17)10-18-15/h1,3-4,6-7,9-10,14H,2,5,8,17H2 |
| InChIKey | KCASNCSJBINIFI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |