About N-[(3Z)-hexa-3,5-dien-3-yl]nitrous amide
N-[(3Z)-hexa-3,5-dien-3-yl]nitrous amide (PubChem CID 146388339) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is N-[(3Z)-hexa-3,5-dien-3-yl]nitrous amide.
Molecular Properties
| Compound Name | N-[(3Z)-hexa-3,5-dien-3-yl]nitrous amide |
| PubChem CID | 146388339 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | N-[(3Z)-hexa-3,5-dien-3-yl]nitrous amide |
| SMILES | C=C/C=C(/CC)NN=O |
| InChI | InChI=1S/C6H10N2O/c1-3-5-6(4-2)7-8-9/h3,5H,1,4H2,2H3,(H,7,9)/b6-5- |
| InChIKey | FWNPQUAZDTVDLF-WAYWQWQTSA-N |
| XLogP | 1.74 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3Z)-hexa-3,5-dien-3-yl]nitrous amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3Z)-hexa-3,5-dien-3-yl]nitrous amide?
The IUPAC name of N-[(3Z)-hexa-3,5-dien-3-yl]nitrous amide (CID 146388339) is N-[(3Z)-hexa-3,5-dien-3-yl]nitrous amide.
What is the SMILES notation for N-[(3Z)-hexa-3,5-dien-3-yl]nitrous amide?
The canonical SMILES for N-[(3Z)-hexa-3,5-dien-3-yl]nitrous amide is C=C/C=C(/CC)NN=O.
What is the InChIKey of N-[(3Z)-hexa-3,5-dien-3-yl]nitrous amide?
The InChIKey is FWNPQUAZDTVDLF-WAYWQWQTSA-N. The full InChI is InChI=1S/C6H10N2O/c1-3-5-6(4-2)7-8-9/h3,5H,1,4H2,2H3,(H,7,9)/b6-5-.
What are the key properties of N-[(3Z)-hexa-3,5-dien-3-yl]nitrous amide?
N-[(3Z)-hexa-3,5-dien-3-yl]nitrous amide has a molecular weight of 126.16 g/mol, XLogP of 1.74, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3Z)-hexa-3,5-dien-3-yl]nitrous amide is sourced from PubChem (CID 146388339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).