About (1-methylpiperidin-4-yl) ethanimidate
(1-methylpiperidin-4-yl) ethanimidate (PubChem CID 146388584) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) ethanimidate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) ethanimidate |
| PubChem CID | 146388584 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (1-methylpiperidin-4-yl) ethanimidate |
| SMILES | [H]/N=C(\C)OC1CCN(C)CC1 |
| InChI | InChI=1S/C8H16N2O/c1-7(9)11-8-3-5-10(2)6-4-8/h8-9H,3-6H2,1-2H3/b9-7+ |
| InChIKey | QVFOUFDURALFRQ-VQHVLOKHSA-N |
| XLogP | 1.09 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpiperidin-4-yl) ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) ethanimidate?
The IUPAC name of (1-methylpiperidin-4-yl) ethanimidate (CID 146388584) is (1-methylpiperidin-4-yl) ethanimidate.
What is the SMILES notation for (1-methylpiperidin-4-yl) ethanimidate?
The canonical SMILES for (1-methylpiperidin-4-yl) ethanimidate is [H]/N=C(\C)OC1CCN(C)CC1.
What is the InChIKey of (1-methylpiperidin-4-yl) ethanimidate?
The InChIKey is QVFOUFDURALFRQ-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H16N2O/c1-7(9)11-8-3-5-10(2)6-4-8/h8-9H,3-6H2,1-2H3/b9-7+.
What are the key properties of (1-methylpiperidin-4-yl) ethanimidate?
(1-methylpiperidin-4-yl) ethanimidate has a molecular weight of 156.23 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) ethanimidate is sourced from PubChem (CID 146388584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).