About 8-[2-(2,5-diazaspiro[3.5]nonan-2-yl)propyl]-2-propan-2-yl-2,8-diazaspiro[3.5]nonane
8-[2-(2,5-diazaspiro[3.5]nonan-2-yl)propyl]-2-propan-2-yl-2,8-diazaspiro[3.5]nonane (PubChem CID 146389006) has the molecular formula C20H38N4
and a molecular weight of 334.55 g/mol. Its IUPAC name is 8-[2-(2,5-diazaspiro[3.5]nonan-2-yl)propyl]-2-propan-2-yl-2,8-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 8-[2-(2,5-diazaspiro[3.5]nonan-2-yl)propyl]-2-propan-2-yl-2,8-diazaspiro[3.5]nonane |
| PubChem CID | 146389006 |
| Molecular Formula | C20H38N4 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.31 |
| IUPAC Name | 8-[2-(2,5-diazaspiro[3.5]nonan-2-yl)propyl]-2-propan-2-yl-2,8-diazaspiro[3.5]nonane |
| SMILES | CC(C)N1CC2(CCCN(CC(C)N3CC4(CCCCN4)C3)C2)C1 |
| InChI | InChI=1S/C20H38N4/c1-17(2)23-13-19(14-23)7-6-10-22(12-19)11-18(3)24-15-20(16-24)8-4-5-9-21-20/h17-18,21H,4-16H2,1-3H3 |
| InChIKey | MOPDUYPFFZBHPK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-[2-(2,5-diazaspiro[3.5]nonan-2-yl)propyl]-2-propan-2-yl-2,8-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[2-(2,5-diazaspiro[3.5]nonan-2-yl)propyl]-2-propan-2-yl-2,8-diazaspiro[3.5]nonane?
The IUPAC name of 8-[2-(2,5-diazaspiro[3.5]nonan-2-yl)propyl]-2-propan-2-yl-2,8-diazaspiro[3.5]nonane (CID 146389006) is 8-[2-(2,5-diazaspiro[3.5]nonan-2-yl)propyl]-2-propan-2-yl-2,8-diazaspiro[3.5]nonane.
What is the SMILES notation for 8-[2-(2,5-diazaspiro[3.5]nonan-2-yl)propyl]-2-propan-2-yl-2,8-diazaspiro[3.5]nonane?
The canonical SMILES for 8-[2-(2,5-diazaspiro[3.5]nonan-2-yl)propyl]-2-propan-2-yl-2,8-diazaspiro[3.5]nonane is CC(C)N1CC2(CCCN(CC(C)N3CC4(CCCCN4)C3)C2)C1.
What is the InChIKey of 8-[2-(2,5-diazaspiro[3.5]nonan-2-yl)propyl]-2-propan-2-yl-2,8-diazaspiro[3.5]nonane?
The InChIKey is MOPDUYPFFZBHPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38N4/c1-17(2)23-13-19(14-23)7-6-10-22(12-19)11-18(3)24-15-20(16-24)8-4-5-9-21-20/h17-18,21H,4-16H2,1-3H3.
What are the key properties of 8-[2-(2,5-diazaspiro[3.5]nonan-2-yl)propyl]-2-propan-2-yl-2,8-diazaspiro[3.5]nonane?
8-[2-(2,5-diazaspiro[3.5]nonan-2-yl)propyl]-2-propan-2-yl-2,8-diazaspiro[3.5]nonane has a molecular weight of 334.55 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[2-(2,5-diazaspiro[3.5]nonan-2-yl)propyl]-2-propan-2-yl-2,8-diazaspiro[3.5]nonane is sourced from PubChem (CID 146389006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).