C25H32F2N2O6 — CID 146389159
methyl (E)-2-[(1S,2S,4S,5S,10S)-5-ethyl-14,15-difluoro-12-methoxy-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11(16),12,14-trien-4-yl]-3-methoxyprop-2-enoate (PubChem CID 146389159) has the molecular formula C25H32F2N2O6 and a molecular weight of 494.54 g/mol. Its IUPAC name is methyl (E)-2-[(1S,2S,4S,5S,10S)-5-ethyl-14,15-difluoro-12-methoxy-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11(16),12,14-trien-4-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[(1S,2S,4S,5S,10S)-5-ethyl-14,15-difluoro-12-methoxy-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11(16),12,14-trien-4-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 146389159 |
| Molecular Formula | C25H32F2N2O6 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | methyl (E)-2-[(1S,2S,4S,5S,10S)-5-ethyl-14,15-difluoro-12-methoxy-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11(16),12,14-trien-4-yl]-3-methoxyprop-2-enoate |
| SMILES | CC[C@@H]1CN2CC[C@@]34OCCO[C@@]3(Nc3c(F)c(F)cc(OC)c34)[C@@H]2C[C@@H]1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C25H32F2N2O6/c1-5-14-12-29-7-6-24-20-18(32-3)11-17(26)21(27)22(20)28-25(24,35-9-8-34-24)19(29)10-15(14)16(13-31-2)23(30)33-4/h11,13-15,19,28H,5-10,12H2,1-4H3/b16-13+/t14-,15+,19+,24+,25+/m1/s1 |
| InChIKey | SUONYAABFZGAGT-QCVWRSFKSA-N |
| XLogP | 3.16 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|