C23H29FN2O4 — CID 146389167
methyl (E)-2-(3-ethyl-10-fluoro-8-methoxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl)-3-methoxyprop-2-enoate (PubChem CID 146389167) has the molecular formula C23H29FN2O4 and a molecular weight of 416.49 g/mol. Its IUPAC name is methyl (E)-2-(3-ethyl-10-fluoro-8-methoxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl)-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-(3-ethyl-10-fluoro-8-methoxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl)-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 146389167 |
| Molecular Formula | C23H29FN2O4 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | methyl (E)-2-(3-ethyl-10-fluoro-8-methoxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl)-3-methoxyprop-2-enoate |
| SMILES | CCC1CN2CCc3c([nH]c4cc(F)cc(OC)c34)C2CC1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C23H29FN2O4/c1-5-13-11-26-7-6-15-21-18(8-14(24)9-20(21)29-3)25-22(15)19(26)10-16(13)17(12-28-2)23(27)30-4/h8-9,12-13,16,19,25H,5-7,10-11H2,1-4H3/b17-12+ |
| InChIKey | MUXSNQRYYHHYOK-SFQUDFHCSA-N |
| XLogP | 3.96 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|