C16H22N2 — CID 146389257
2-tert-butyl-7,7-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene (PubChem CID 146389257) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-tert-butyl-7,7-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene.
| Compound Name | 2-tert-butyl-7,7-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene |
|---|---|
| PubChem CID | 146389257 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2-tert-butyl-7,7-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene |
| SMILES | CC1(C)CCc2cn(C(C)(C)C)c3ccnc1c23 |
| InChI | InChI=1S/C16H22N2/c1-15(2,3)18-10-11-6-8-16(4,5)14-13(11)12(18)7-9-17-14/h7,9-10H,6,8H2,1-5H3 |
| InChIKey | YNRGGOMAVUFXQA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |