About ethyl 4-[4,6-dimethyl-3-(trifluoromethyl)-2-pyridinyl]-2-oxo-5-propan-2-ylcyclohexane-1-carboxylate
ethyl 4-[4,6-dimethyl-3-(trifluoromethyl)-2-pyridinyl]-2-oxo-5-propan-2-ylcyclohexane-1-carboxylate (PubChem CID 146389652) has the molecular formula C20H26F3NO3
and a molecular weight of 385.43 g/mol. Its IUPAC name is ethyl 4-[4,6-dimethyl-3-(trifluoromethyl)-2-pyridinyl]-2-oxo-5-propan-2-ylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[4,6-dimethyl-3-(trifluoromethyl)-2-pyridinyl]-2-oxo-5-propan-2-ylcyclohexane-1-carboxylate |
| PubChem CID | 146389652 |
| Molecular Formula | C20H26F3NO3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | ethyl 4-[4,6-dimethyl-3-(trifluoromethyl)-2-pyridinyl]-2-oxo-5-propan-2-ylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(C(C)C)C(c2nc(C)cc(C)c2C(F)(F)F)CC1=O |
| InChI | InChI=1S/C20H26F3NO3/c1-6-27-19(26)15-8-13(10(2)3)14(9-16(15)25)18-17(20(21,22)23)11(4)7-12(5)24-18/h7,10,13-15H,6,8-9H2,1-5H3 |
| InChIKey | DVERCAJKOKGIHY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[4,6-dimethyl-3-(trifluoromethyl)-2-pyridinyl]-2-oxo-5-propan-2-ylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[4,6-dimethyl-3-(trifluoromethyl)-2-pyridinyl]-2-oxo-5-propan-2-ylcyclohexane-1-carboxylate?
The IUPAC name of ethyl 4-[4,6-dimethyl-3-(trifluoromethyl)-2-pyridinyl]-2-oxo-5-propan-2-ylcyclohexane-1-carboxylate (CID 146389652) is ethyl 4-[4,6-dimethyl-3-(trifluoromethyl)-2-pyridinyl]-2-oxo-5-propan-2-ylcyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 4-[4,6-dimethyl-3-(trifluoromethyl)-2-pyridinyl]-2-oxo-5-propan-2-ylcyclohexane-1-carboxylate?
The canonical SMILES for ethyl 4-[4,6-dimethyl-3-(trifluoromethyl)-2-pyridinyl]-2-oxo-5-propan-2-ylcyclohexane-1-carboxylate is CCOC(=O)C1CC(C(C)C)C(c2nc(C)cc(C)c2C(F)(F)F)CC1=O.
What is the InChIKey of ethyl 4-[4,6-dimethyl-3-(trifluoromethyl)-2-pyridinyl]-2-oxo-5-propan-2-ylcyclohexane-1-carboxylate?
The InChIKey is DVERCAJKOKGIHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26F3NO3/c1-6-27-19(26)15-8-13(10(2)3)14(9-16(15)25)18-17(20(21,22)23)11(4)7-12(5)24-18/h7,10,13-15H,6,8-9H2,1-5H3.
What are the key properties of ethyl 4-[4,6-dimethyl-3-(trifluoromethyl)-2-pyridinyl]-2-oxo-5-propan-2-ylcyclohexane-1-carboxylate?
ethyl 4-[4,6-dimethyl-3-(trifluoromethyl)-2-pyridinyl]-2-oxo-5-propan-2-ylcyclohexane-1-carboxylate has a molecular weight of 385.43 g/mol, XLogP of 4.62, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[4,6-dimethyl-3-(trifluoromethyl)-2-pyridinyl]-2-oxo-5-propan-2-ylcyclohexane-1-carboxylate is sourced from PubChem (CID 146389652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).