About 3-[2-fluoro-3,5-dimethyl-6-(trifluoromethyl)phenyl]-4-methylcyclohexan-1-one
3-[2-fluoro-3,5-dimethyl-6-(trifluoromethyl)phenyl]-4-methylcyclohexan-1-one (PubChem CID 146389675) has the molecular formula C16H18F4O
and a molecular weight of 302.31 g/mol. Its IUPAC name is 3-[2-fluoro-3,5-dimethyl-6-(trifluoromethyl)phenyl]-4-methylcyclohexan-1-one.
Molecular Properties
| Compound Name | 3-[2-fluoro-3,5-dimethyl-6-(trifluoromethyl)phenyl]-4-methylcyclohexan-1-one |
| PubChem CID | 146389675 |
| Molecular Formula | C16H18F4O |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 3-[2-fluoro-3,5-dimethyl-6-(trifluoromethyl)phenyl]-4-methylcyclohexan-1-one |
| SMILES | Cc1cc(C)c(C(F)(F)F)c(C2CC(=O)CCC2C)c1F |
| InChI | InChI=1S/C16H18F4O/c1-8-4-5-11(21)7-12(8)13-14(16(18,19)20)9(2)6-10(3)15(13)17/h6,8,12H,4-5,7H2,1-3H3 |
| InChIKey | GEPGPBABWWFKSO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[2-fluoro-3,5-dimethyl-6-(trifluoromethyl)phenyl]-4-methylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-fluoro-3,5-dimethyl-6-(trifluoromethyl)phenyl]-4-methylcyclohexan-1-one?
The IUPAC name of 3-[2-fluoro-3,5-dimethyl-6-(trifluoromethyl)phenyl]-4-methylcyclohexan-1-one (CID 146389675) is 3-[2-fluoro-3,5-dimethyl-6-(trifluoromethyl)phenyl]-4-methylcyclohexan-1-one.
What is the SMILES notation for 3-[2-fluoro-3,5-dimethyl-6-(trifluoromethyl)phenyl]-4-methylcyclohexan-1-one?
The canonical SMILES for 3-[2-fluoro-3,5-dimethyl-6-(trifluoromethyl)phenyl]-4-methylcyclohexan-1-one is Cc1cc(C)c(C(F)(F)F)c(C2CC(=O)CCC2C)c1F.
What is the InChIKey of 3-[2-fluoro-3,5-dimethyl-6-(trifluoromethyl)phenyl]-4-methylcyclohexan-1-one?
The InChIKey is GEPGPBABWWFKSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F4O/c1-8-4-5-11(21)7-12(8)13-14(16(18,19)20)9(2)6-10(3)15(13)17/h6,8,12H,4-5,7H2,1-3H3.
What are the key properties of 3-[2-fluoro-3,5-dimethyl-6-(trifluoromethyl)phenyl]-4-methylcyclohexan-1-one?
3-[2-fluoro-3,5-dimethyl-6-(trifluoromethyl)phenyl]-4-methylcyclohexan-1-one has a molecular weight of 302.31 g/mol, XLogP of 4.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-fluoro-3,5-dimethyl-6-(trifluoromethyl)phenyl]-4-methylcyclohexan-1-one is sourced from PubChem (CID 146389675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).