C11H17F2N3 — CID 146389779
4-[1-(2,2-difluoroethyl)pyrazol-4-yl]cyclohexan-1-amine (PubChem CID 146389779) has the molecular formula C11H17F2N3 and a molecular weight of 229.27 g/mol. Its IUPAC name is 4-[1-(2,2-difluoroethyl)pyrazol-4-yl]cyclohexan-1-amine.
| Compound Name | 4-[1-(2,2-difluoroethyl)pyrazol-4-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 146389779 |
| Molecular Formula | C11H17F2N3 |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 4-[1-(2,2-difluoroethyl)pyrazol-4-yl]cyclohexan-1-amine |
| SMILES | NC1CCC(c2cnn(CC(F)F)c2)CC1 |
| InChI | InChI=1S/C11H17F2N3/c12-11(13)7-16-6-9(5-15-16)8-1-3-10(14)4-2-8/h5-6,8,10-11H,1-4,7,14H2 |
| InChIKey | OOLLYFJUNVQTIB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |