C11H16F3N3 — CID 146389784
4-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]cyclohexan-1-amine (PubChem CID 146389784) has the molecular formula C11H16F3N3 and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]cyclohexan-1-amine.
| Compound Name | 4-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 146389784 |
| Molecular Formula | C11H16F3N3 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 4-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]cyclohexan-1-amine |
| SMILES | NC1CCC(c2cnn(CC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C11H16F3N3/c12-11(13,14)7-17-6-9(5-16-17)8-1-3-10(15)4-2-8/h5-6,8,10H,1-4,7,15H2 |
| InChIKey | SOAODTKWHOSQLB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |