About bis(4-formylphenyl) phenyl phosphite
bis(4-formylphenyl) phenyl phosphite (PubChem CID 146390093) has the molecular formula C20H15O5P
and a molecular weight of 366.31 g/mol. Its IUPAC name is bis(4-formylphenyl) phenyl phosphite.
Molecular Properties
| Compound Name | bis(4-formylphenyl) phenyl phosphite |
| PubChem CID | 146390093 |
| Molecular Formula | C20H15O5P |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | bis(4-formylphenyl) phenyl phosphite |
| SMILES | O=Cc1ccc(OP(Oc2ccccc2)Oc2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C20H15O5P/c21-14-16-6-10-19(11-7-16)24-26(23-18-4-2-1-3-5-18)25-20-12-8-17(15-22)9-13-20/h1-15H |
| InChIKey | DGGBLWOSJAZOCK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(4-formylphenyl) phenyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-formylphenyl) phenyl phosphite?
The IUPAC name of bis(4-formylphenyl) phenyl phosphite (CID 146390093) is bis(4-formylphenyl) phenyl phosphite.
What is the SMILES notation for bis(4-formylphenyl) phenyl phosphite?
The canonical SMILES for bis(4-formylphenyl) phenyl phosphite is O=Cc1ccc(OP(Oc2ccccc2)Oc2ccc(C=O)cc2)cc1.
What is the InChIKey of bis(4-formylphenyl) phenyl phosphite?
The InChIKey is DGGBLWOSJAZOCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15O5P/c21-14-16-6-10-19(11-7-16)24-26(23-18-4-2-1-3-5-18)25-20-12-8-17(15-22)9-13-20/h1-15H.
What are the key properties of bis(4-formylphenyl) phenyl phosphite?
bis(4-formylphenyl) phenyl phosphite has a molecular weight of 366.31 g/mol, XLogP of 5.08, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-formylphenyl) phenyl phosphite is sourced from PubChem (CID 146390093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).