C27H27F6NO5S — CID 146390605
[3-[[3-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]sulfanyl]-1,1-difluoropropoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate (PubChem CID 146390605) has the molecular formula C27H27F6NO5S and a molecular weight of 591.57 g/mol. Its IUPAC name is [3-[[3-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]sulfanyl]-1,1-difluoropropoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate.
| Compound Name | [3-[[3-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]sulfanyl]-1,1-difluoropropoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390605 |
| Molecular Formula | C27H27F6NO5S |
| Molecular Weight | 591.57 g/mol |
| Exact Mass | 591.15 |
| IUPAC Name | [3-[[3-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]sulfanyl]-1,1-difluoropropoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(F)(F)OC(F)(F)OC(F)(F)CCSc1ccc2cc(-c3ccc(CC)nc3CC)oc2c1 |
| InChI | InChI=1S/C27H27F6NO5S/c1-4-18-8-10-20(21(5-2)34-18)23-15-17-7-9-19(16-22(17)37-23)40-14-12-26(30,31)39-27(32,33)38-25(28,29)11-13-36-24(35)6-3/h6-10,15-16H,3-5,11-14H2,1-2H3 |
| InChIKey | KSVCLAHOQDMXNO-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.57 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|