C24H21F6NO5S — CID 146390608
[3-[[1,1-difluoro-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate (PubChem CID 146390608) has the molecular formula C24H21F6NO5S and a molecular weight of 549.49 g/mol. Its IUPAC name is [3-[[1,1-difluoro-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[[1,1-difluoro-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146390608 |
| Molecular Formula | C24H21F6NO5S |
| Molecular Weight | 549.49 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | [3-[[1,1-difluoro-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(F)(F)OC(F)(F)OC(F)(F)CCSc1ccc2cc(-c3cccnc3)oc2c1 |
| InChI | InChI=1S/C24H21F6NO5S/c1-15(2)21(32)33-10-7-22(25,26)35-24(29,30)36-23(27,28)8-11-37-18-6-5-16-12-19(34-20(16)13-18)17-4-3-9-31-14-17/h3-6,9,12-14H,1,7-8,10-11H2,2H3 |
| InChIKey | TXBYOTSUZQSMKP-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.49 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|