About dimethyl [1,2,4]triazolo[1,5-b]pyridazine-7,8-dicarboxylate
dimethyl [1,2,4]triazolo[1,5-b]pyridazine-7,8-dicarboxylate (PubChem CID 14639061) has the molecular formula C9H8N4O4
and a molecular weight of 236.19 g/mol. Its IUPAC name is dimethyl [1,2,4]triazolo[1,5-b]pyridazine-7,8-dicarboxylate.
Analyze dimethyl [1,2,4]triazolo[1,5-b]pyridazine-7,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl [1,2,4]triazolo[1,5-b]pyridazine-7,8-dicarboxylate?
The IUPAC name of dimethyl [1,2,4]triazolo[1,5-b]pyridazine-7,8-dicarboxylate (CID 14639061) is dimethyl [1,2,4]triazolo[1,5-b]pyridazine-7,8-dicarboxylate.
What is the SMILES notation for dimethyl [1,2,4]triazolo[1,5-b]pyridazine-7,8-dicarboxylate?
The canonical SMILES for dimethyl [1,2,4]triazolo[1,5-b]pyridazine-7,8-dicarboxylate is COC(=O)c1cnn2ncnc2c1C(=O)OC.
What is the InChIKey of dimethyl [1,2,4]triazolo[1,5-b]pyridazine-7,8-dicarboxylate?
The InChIKey is XSUCVWSIBSHXQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O4/c1-16-8(14)5-3-11-13-7(10-4-12-13)6(5)9(15)17-2/h3-4H,1-2H3.
What are the key properties of dimethyl [1,2,4]triazolo[1,5-b]pyridazine-7,8-dicarboxylate?
dimethyl [1,2,4]triazolo[1,5-b]pyridazine-7,8-dicarboxylate has a molecular weight of 236.19 g/mol, XLogP of -0.30, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl [1,2,4]triazolo[1,5-b]pyridazine-7,8-dicarboxylate is sourced from PubChem (CID 14639061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).