C25H26F3NO3S — CID 146390624
[2-[[2-(2,6-diethyl-3-pyridinyl)-1-benzothiophen-6-yl]oxymethyl]-4,4,4-trifluorobutyl] prop-2-enoate (PubChem CID 146390624) has the molecular formula C25H26F3NO3S and a molecular weight of 477.55 g/mol. Its IUPAC name is [2-[[2-(2,6-diethyl-3-pyridinyl)-1-benzothiophen-6-yl]oxymethyl]-4,4,4-trifluorobutyl] prop-2-enoate.
| Compound Name | [2-[[2-(2,6-diethyl-3-pyridinyl)-1-benzothiophen-6-yl]oxymethyl]-4,4,4-trifluorobutyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390624 |
| Molecular Formula | C25H26F3NO3S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | [2-[[2-(2,6-diethyl-3-pyridinyl)-1-benzothiophen-6-yl]oxymethyl]-4,4,4-trifluorobutyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COc1ccc2cc(-c3ccc(CC)nc3CC)sc2c1)CC(F)(F)F |
| InChI | InChI=1S/C25H26F3NO3S/c1-4-18-8-10-20(21(5-2)29-18)23-11-17-7-9-19(12-22(17)33-23)31-14-16(13-25(26,27)28)15-32-24(30)6-3/h6-12,16H,3-5,13-15H2,1-2H3 |
| InChIKey | CWOIQQVSRRNNCG-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|