C27H25F8NO3S — CID 146390638
[8-[[2-(6-ethyl-2-methyl-3-pyridinyl)-1-benzothiophen-6-yl]oxy]-3,3,4,4,5,5,6,6-octafluorooctyl] prop-2-enoate (PubChem CID 146390638) has the molecular formula C27H25F8NO3S and a molecular weight of 595.55 g/mol. Its IUPAC name is [8-[[2-(6-ethyl-2-methyl-3-pyridinyl)-1-benzothiophen-6-yl]oxy]-3,3,4,4,5,5,6,6-octafluorooctyl] prop-2-enoate.
| Compound Name | [8-[[2-(6-ethyl-2-methyl-3-pyridinyl)-1-benzothiophen-6-yl]oxy]-3,3,4,4,5,5,6,6-octafluorooctyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390638 |
| Molecular Formula | C27H25F8NO3S |
| Molecular Weight | 595.55 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | [8-[[2-(6-ethyl-2-methyl-3-pyridinyl)-1-benzothiophen-6-yl]oxy]-3,3,4,4,5,5,6,6-octafluorooctyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOc1ccc2cc(-c3ccc(CC)nc3C)sc2c1 |
| InChI | InChI=1S/C27H25F8NO3S/c1-4-18-7-9-20(16(3)36-18)22-14-17-6-8-19(15-21(17)40-22)38-12-10-24(28,29)26(32,33)27(34,35)25(30,31)11-13-39-23(37)5-2/h5-9,14-15H,2,4,10-13H2,1,3H3 |
| InChIKey | UANACPTXOMQKSB-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.55 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|