C34H41F6NO4 — CID 146390649
[4,4,4-trifluoro-2-[[1-(4-methylpentyl)-2-[4-pentyl-2-(trifluoromethoxy)phenyl]indol-6-yl]oxymethyl]butyl] prop-2-enoate (PubChem CID 146390649) has the molecular formula C34H41F6NO4 and a molecular weight of 641.69 g/mol. Its IUPAC name is [4,4,4-trifluoro-2-[[1-(4-methylpentyl)-2-[4-pentyl-2-(trifluoromethoxy)phenyl]indol-6-yl]oxymethyl]butyl] prop-2-enoate.
| Compound Name | [4,4,4-trifluoro-2-[[1-(4-methylpentyl)-2-[4-pentyl-2-(trifluoromethoxy)phenyl]indol-6-yl]oxymethyl]butyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390649 |
| Molecular Formula | C34H41F6NO4 |
| Molecular Weight | 641.69 g/mol |
| Exact Mass | 641.29 |
| IUPAC Name | [4,4,4-trifluoro-2-[[1-(4-methylpentyl)-2-[4-pentyl-2-(trifluoromethoxy)phenyl]indol-6-yl]oxymethyl]butyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COc1ccc2cc(-c3ccc(CCCCC)cc3OC(F)(F)F)n(CCCC(C)C)c2c1)CC(F)(F)F |
| InChI | InChI=1S/C34H41F6NO4/c1-5-7-8-11-24-12-15-28(31(17-24)45-34(38,39)40)30-18-26-13-14-27(19-29(26)41(30)16-9-10-23(3)4)43-21-25(20-33(35,36)37)22-44-32(42)6-2/h6,12-15,17-19,23,25H,2,5,7-11,16,20-22H2,1,3-4H3 |
| InChIKey | RHKXLPBCPHHDKB-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.69 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|