C36H45F6NO3 — CID 146390651
[4,4,4-trifluoro-2-methyl-2-[[1-(4-methylpentyl)-2-[4-pentyl-2-(trifluoromethyl)phenyl]indol-6-yl]oxymethyl]butyl] 2-methylprop-2-enoate (PubChem CID 146390651) has the molecular formula C36H45F6NO3 and a molecular weight of 653.75 g/mol. Its IUPAC name is [4,4,4-trifluoro-2-methyl-2-[[1-(4-methylpentyl)-2-[4-pentyl-2-(trifluoromethyl)phenyl]indol-6-yl]oxymethyl]butyl] 2-methylprop-2-enoate.
| Compound Name | [4,4,4-trifluoro-2-methyl-2-[[1-(4-methylpentyl)-2-[4-pentyl-2-(trifluoromethyl)phenyl]indol-6-yl]oxymethyl]butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146390651 |
| Molecular Formula | C36H45F6NO3 |
| Molecular Weight | 653.75 g/mol |
| Exact Mass | 653.33 |
| IUPAC Name | [4,4,4-trifluoro-2-methyl-2-[[1-(4-methylpentyl)-2-[4-pentyl-2-(trifluoromethyl)phenyl]indol-6-yl]oxymethyl]butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)(COc1ccc2cc(-c3ccc(CCCCC)cc3C(F)(F)F)n(CCCC(C)C)c2c1)CC(F)(F)F |
| InChI | InChI=1S/C36H45F6NO3/c1-7-8-9-12-26-13-16-29(30(18-26)36(40,41)42)32-19-27-14-15-28(20-31(27)43(32)17-10-11-24(2)3)45-22-34(6,21-35(37,38)39)23-46-33(44)25(4)5/h13-16,18-20,24H,4,7-12,17,21-23H2,1-3,5-6H3 |
| InChIKey | OGIWOYDULXLMQQ-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.75 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|