C34H41F6NO3 — CID 146390653
[4,4,4-trifluoro-2-methyl-2-[[1-pentyl-2-[4-pentyl-2-(trifluoromethyl)phenyl]indol-6-yl]oxymethyl]butyl] prop-2-enoate (PubChem CID 146390653) has the molecular formula C34H41F6NO3 and a molecular weight of 625.69 g/mol. Its IUPAC name is [4,4,4-trifluoro-2-methyl-2-[[1-pentyl-2-[4-pentyl-2-(trifluoromethyl)phenyl]indol-6-yl]oxymethyl]butyl] prop-2-enoate.
| Compound Name | [4,4,4-trifluoro-2-methyl-2-[[1-pentyl-2-[4-pentyl-2-(trifluoromethyl)phenyl]indol-6-yl]oxymethyl]butyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390653 |
| Molecular Formula | C34H41F6NO3 |
| Molecular Weight | 625.69 g/mol |
| Exact Mass | 625.30 |
| IUPAC Name | [4,4,4-trifluoro-2-methyl-2-[[1-pentyl-2-[4-pentyl-2-(trifluoromethyl)phenyl]indol-6-yl]oxymethyl]butyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(COc1ccc2cc(-c3ccc(CCCCC)cc3C(F)(F)F)n(CCCCC)c2c1)CC(F)(F)F |
| InChI | InChI=1S/C34H41F6NO3/c1-5-8-10-12-24-13-16-27(28(18-24)34(38,39)40)30-19-25-14-15-26(20-29(25)41(30)17-11-9-6-2)43-22-32(4,21-33(35,36)37)23-44-31(42)7-3/h7,13-16,18-20H,3,5-6,8-12,17,21-23H2,1-2,4H3 |
| InChIKey | AGYRSIBORBBVGY-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.69 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|