C33H37F8NO3 — CID 146390665
[3,3,4,4,5,5,6,6-octafluoro-8-[1-methyl-2-(2-methyl-4-pentylphenyl)indol-6-yl]oxyoctyl] 2-methylprop-2-enoate (PubChem CID 146390665) has the molecular formula C33H37F8NO3 and a molecular weight of 647.65 g/mol. Its IUPAC name is [3,3,4,4,5,5,6,6-octafluoro-8-[1-methyl-2-(2-methyl-4-pentylphenyl)indol-6-yl]oxyoctyl] 2-methylprop-2-enoate.
| Compound Name | [3,3,4,4,5,5,6,6-octafluoro-8-[1-methyl-2-(2-methyl-4-pentylphenyl)indol-6-yl]oxyoctyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146390665 |
| Molecular Formula | C33H37F8NO3 |
| Molecular Weight | 647.65 g/mol |
| Exact Mass | 647.26 |
| IUPAC Name | [3,3,4,4,5,5,6,6-octafluoro-8-[1-methyl-2-(2-methyl-4-pentylphenyl)indol-6-yl]oxyoctyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOc1ccc2cc(-c3ccc(CCCCC)cc3C)n(C)c2c1 |
| InChI | InChI=1S/C33H37F8NO3/c1-6-7-8-9-23-10-13-26(22(4)18-23)28-19-24-11-12-25(20-27(24)42(28)5)44-16-14-30(34,35)32(38,39)33(40,41)31(36,37)15-17-45-29(43)21(2)3/h10-13,18-20H,2,6-9,14-17H2,1,3-5H3 |
| InChIKey | CGKGUELMNPXBIV-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.65 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|