C34H39F8NO3 — CID 146390671
[8-[1-ethyl-2-(2-ethyl-4-pentylphenyl)indol-6-yl]oxy-3,3,4,4,5,5,6,6-octafluorooctyl] prop-2-enoate (PubChem CID 146390671) has the molecular formula C34H39F8NO3 and a molecular weight of 661.67 g/mol. Its IUPAC name is [8-[1-ethyl-2-(2-ethyl-4-pentylphenyl)indol-6-yl]oxy-3,3,4,4,5,5,6,6-octafluorooctyl] prop-2-enoate.
| Compound Name | [8-[1-ethyl-2-(2-ethyl-4-pentylphenyl)indol-6-yl]oxy-3,3,4,4,5,5,6,6-octafluorooctyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390671 |
| Molecular Formula | C34H39F8NO3 |
| Molecular Weight | 661.67 g/mol |
| Exact Mass | 661.28 |
| IUPAC Name | [8-[1-ethyl-2-(2-ethyl-4-pentylphenyl)indol-6-yl]oxy-3,3,4,4,5,5,6,6-octafluorooctyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOc1ccc2cc(-c3ccc(CCCCC)cc3CC)n(CC)c2c1 |
| InChI | InChI=1S/C34H39F8NO3/c1-5-9-10-11-23-12-15-27(24(6-2)20-23)29-21-25-13-14-26(22-28(25)43(29)8-4)45-18-16-31(35,36)33(39,40)34(41,42)32(37,38)17-19-46-30(44)7-3/h7,12-15,20-22H,3,5-6,8-11,16-19H2,1-2,4H3 |
| InChIKey | DMBNSHPZSBXLLO-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.67 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|